C20H22F2N2O2 — CID 126449277
3-(3,4-difluoro-5-hydroxyphenyl)-N-[2-[(2S)-piperidin-2-yl]ethyl]benzamide (PubChem CID 126449277) has the molecular formula C20H22F2N2O2 and a molecular weight of 360.40 g/mol. Its IUPAC name is 3-(3,4-difluoro-5-hydroxyphenyl)-N-[2-[(2S)-piperidin-2-yl]ethyl]benzamide.
| Compound Name | 3-(3,4-difluoro-5-hydroxyphenyl)-N-[2-[(2S)-piperidin-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 126449277 |
| Molecular Formula | C20H22F2N2O2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 3-(3,4-difluoro-5-hydroxyphenyl)-N-[2-[(2S)-piperidin-2-yl]ethyl]benzamide |
| SMILES | O=C(NCC[C@@H]1CCCCN1)c1cccc(-c2cc(O)c(F)c(F)c2)c1 |
| InChI | InChI=1S/C20H22F2N2O2/c21-17-11-15(12-18(25)19(17)22)13-4-3-5-14(10-13)20(26)24-9-7-16-6-1-2-8-23-16/h3-5,10-12,16,23,25H,1-2,6-9H2,(H,24,26)/t16-/m0/s1 |
| InChIKey | UMBHDGSZPMPCKT-INIZCTEOSA-N |
| XLogP | 3.60 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |