About 1,1-diethylcyclohexane
1,1-diethylcyclohexane (PubChem CID 12644944) has the molecular formula C10H20
and a molecular weight of 140.27 g/mol. Its IUPAC name is 1,1-diethylcyclohexane.
Molecular Properties
| Compound Name | 1,1-diethylcyclohexane |
| PubChem CID | 12644944 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | 1,1-diethylcyclohexane |
| SMILES | CCC1(CC)CCCCC1 |
| InChI | InChI=1S/C10H20/c1-3-10(4-2)8-6-5-7-9-10/h3-9H2,1-2H3 |
| InChIKey | GCYUJISWSVALJD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-diethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethylcyclohexane?
The IUPAC name of 1,1-diethylcyclohexane (CID 12644944) is 1,1-diethylcyclohexane.
What is the SMILES notation for 1,1-diethylcyclohexane?
The canonical SMILES for 1,1-diethylcyclohexane is CCC1(CC)CCCCC1.
What is the InChIKey of 1,1-diethylcyclohexane?
The InChIKey is GCYUJISWSVALJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20/c1-3-10(4-2)8-6-5-7-9-10/h3-9H2,1-2H3.
What are the key properties of 1,1-diethylcyclohexane?
1,1-diethylcyclohexane has a molecular weight of 140.27 g/mol, XLogP of 3.76, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethylcyclohexane is sourced from PubChem (CID 12644944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).