About N-[(4S)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]pyrrolidine-1-carboxamide
N-[(4S)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]pyrrolidine-1-carboxamide (PubChem CID 126449547) has the molecular formula C14H17N3O2
and a molecular weight of 259.31 g/mol. Its IUPAC name is N-[(4S)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | N-[(4S)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]pyrrolidine-1-carboxamide |
| PubChem CID | 126449547 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-[(4S)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]pyrrolidine-1-carboxamide |
| SMILES | O=C1C[C@H](NC(=O)N2CCCC2)c2ccccc2N1 |
| InChI | InChI=1S/C14H17N3O2/c18-13-9-12(10-5-1-2-6-11(10)15-13)16-14(19)17-7-3-4-8-17/h1-2,5-6,12H,3-4,7-9H2,(H,15,18)(H,16,19)/t12-/m0/s1 |
| InChIKey | MDLBDJQXRFHBKB-LBPRGKRZSA-N |
| XLogP | 1.88 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(4S)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4S)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]pyrrolidine-1-carboxamide?
The IUPAC name of N-[(4S)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]pyrrolidine-1-carboxamide (CID 126449547) is N-[(4S)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]pyrrolidine-1-carboxamide.
What is the SMILES notation for N-[(4S)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]pyrrolidine-1-carboxamide?
The canonical SMILES for N-[(4S)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]pyrrolidine-1-carboxamide is O=C1C[C@H](NC(=O)N2CCCC2)c2ccccc2N1.
What is the InChIKey of N-[(4S)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]pyrrolidine-1-carboxamide?
The InChIKey is MDLBDJQXRFHBKB-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H17N3O2/c18-13-9-12(10-5-1-2-6-11(10)15-13)16-14(19)17-7-3-4-8-17/h1-2,5-6,12H,3-4,7-9H2,(H,15,18)(H,16,19)/t12-/m0/s1.
What are the key properties of N-[(4S)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]pyrrolidine-1-carboxamide?
N-[(4S)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]pyrrolidine-1-carboxamide has a molecular weight of 259.31 g/mol, XLogP of 1.88, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4S)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]pyrrolidine-1-carboxamide is sourced from PubChem (CID 126449547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).