C17H27N3 — CID 126449596
1-(3,5-dimethylphenyl)-N-[(3S)-pyrrolidin-3-yl]piperidin-4-amine (PubChem CID 126449596) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-N-[(3S)-pyrrolidin-3-yl]piperidin-4-amine.
| Compound Name | 1-(3,5-dimethylphenyl)-N-[(3S)-pyrrolidin-3-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 126449596 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-N-[(3S)-pyrrolidin-3-yl]piperidin-4-amine |
| SMILES | Cc1cc(C)cc(N2CCC(N[C@H]3CCNC3)CC2)c1 |
| InChI | InChI=1S/C17H27N3/c1-13-9-14(2)11-17(10-13)20-7-4-15(5-8-20)19-16-3-6-18-12-16/h9-11,15-16,18-19H,3-8,12H2,1-2H3/t16-/m0/s1 |
| InChIKey | WHRYOKLEGBETSR-INIZCTEOSA-N |
| XLogP | 2.22 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |