C21H30N4O2 — CID 126449902
N-[[(3R)-1-cyclopentyl-5-oxopyrrolidin-3-yl]methyl]-4-phenylpiperazine-1-carboxamide (PubChem CID 126449902) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-[[(3R)-1-cyclopentyl-5-oxopyrrolidin-3-yl]methyl]-4-phenylpiperazine-1-carboxamide.
| Compound Name | N-[[(3R)-1-cyclopentyl-5-oxopyrrolidin-3-yl]methyl]-4-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 126449902 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N-[[(3R)-1-cyclopentyl-5-oxopyrrolidin-3-yl]methyl]-4-phenylpiperazine-1-carboxamide |
| SMILES | O=C(NC[C@H]1CC(=O)N(C2CCCC2)C1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H30N4O2/c26-20-14-17(16-25(20)19-8-4-5-9-19)15-22-21(27)24-12-10-23(11-13-24)18-6-2-1-3-7-18/h1-3,6-7,17,19H,4-5,8-16H2,(H,22,27)/t17-/m1/s1 |
| InChIKey | OZCLHTUIHXBSKQ-QGZVFWFLSA-N |
| XLogP | 2.31 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |