C12H21N5O — CID 126449965
2-[(2S)-1-methylpiperidin-2-yl]-N-[2-(2H-triazol-4-yl)ethyl]acetamide (PubChem CID 126449965) has the molecular formula C12H21N5O and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-[(2S)-1-methylpiperidin-2-yl]-N-[2-(2H-triazol-4-yl)ethyl]acetamide.
| Compound Name | 2-[(2S)-1-methylpiperidin-2-yl]-N-[2-(2H-triazol-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 126449965 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-[(2S)-1-methylpiperidin-2-yl]-N-[2-(2H-triazol-4-yl)ethyl]acetamide |
| SMILES | CN1CCCC[C@H]1CC(=O)NCCc1cn[nH]n1 |
| InChI | InChI=1S/C12H21N5O/c1-17-7-3-2-4-11(17)8-12(18)13-6-5-10-9-14-16-15-10/h9,11H,2-8H2,1H3,(H,13,18)(H,14,15,16)/t11-/m0/s1 |
| InChIKey | XYDNYWAFRRXBBE-NSHDSACASA-N |
| XLogP | 0.34 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |