C22H27NO3 — CID 126450863
4-[3-[(1S)-1-hydroxyethyl]phenyl]-N-[1-(methoxymethyl)cyclopentyl]benzamide (PubChem CID 126450863) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 4-[3-[(1S)-1-hydroxyethyl]phenyl]-N-[1-(methoxymethyl)cyclopentyl]benzamide.
| Compound Name | 4-[3-[(1S)-1-hydroxyethyl]phenyl]-N-[1-(methoxymethyl)cyclopentyl]benzamide |
|---|---|
| PubChem CID | 126450863 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 4-[3-[(1S)-1-hydroxyethyl]phenyl]-N-[1-(methoxymethyl)cyclopentyl]benzamide |
| SMILES | COCC1(NC(=O)c2ccc(-c3cccc([C@H](C)O)c3)cc2)CCCC1 |
| InChI | InChI=1S/C22H27NO3/c1-16(24)19-6-5-7-20(14-19)17-8-10-18(11-9-17)21(25)23-22(15-26-2)12-3-4-13-22/h5-11,14,16,24H,3-4,12-13,15H2,1-2H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | WRLLUVPZOPNROV-INIZCTEOSA-N |
| XLogP | 4.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |