C14H22N4O2 — CID 126450963
(2S)-1-[4-(2-aminopyrimidin-4-yl)piperidin-1-yl]-2-ethoxypropan-1-one (PubChem CID 126450963) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is (2S)-1-[4-(2-aminopyrimidin-4-yl)piperidin-1-yl]-2-ethoxypropan-1-one.
| Compound Name | (2S)-1-[4-(2-aminopyrimidin-4-yl)piperidin-1-yl]-2-ethoxypropan-1-one |
|---|---|
| PubChem CID | 126450963 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (2S)-1-[4-(2-aminopyrimidin-4-yl)piperidin-1-yl]-2-ethoxypropan-1-one |
| SMILES | CCO[C@@H](C)C(=O)N1CCC(c2ccnc(N)n2)CC1 |
| InChI | InChI=1S/C14H22N4O2/c1-3-20-10(2)13(19)18-8-5-11(6-9-18)12-4-7-16-14(15)17-12/h4,7,10-11H,3,5-6,8-9H2,1-2H3,(H2,15,16,17)/t10-/m0/s1 |
| InChIKey | WTPLWPPFAKDEPE-JTQLQIEISA-N |
| XLogP | 1.19 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |