About 4-[[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]methyl]-2-methyl-1,3-oxazole
4-[[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]methyl]-2-methyl-1,3-oxazole (PubChem CID 126451372) has the molecular formula C17H22N2O
and a molecular weight of 270.38 g/mol. Its IUPAC name is 4-[[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]methyl]-2-methyl-1,3-oxazole.
Molecular Properties
| Compound Name | 4-[[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]methyl]-2-methyl-1,3-oxazole |
| PubChem CID | 126451372 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 4-[[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]methyl]-2-methyl-1,3-oxazole |
| SMILES | Cc1nc(CN2C[C@H](c3ccccc3)C(C)(C)C2)co1 |
| InChI | InChI=1S/C17H22N2O/c1-13-18-15(11-20-13)9-19-10-16(17(2,3)12-19)14-7-5-4-6-8-14/h4-8,11,16H,9-10,12H2,1-3H3/t16-/m1/s1 |
| InChIKey | BHMGNOLLQPCBIA-MRXNPFEDSA-N |
| XLogP | 3.61 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]methyl]-2-methyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]methyl]-2-methyl-1,3-oxazole?
The IUPAC name of 4-[[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]methyl]-2-methyl-1,3-oxazole (CID 126451372) is 4-[[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]methyl]-2-methyl-1,3-oxazole.
What is the SMILES notation for 4-[[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]methyl]-2-methyl-1,3-oxazole?
The canonical SMILES for 4-[[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]methyl]-2-methyl-1,3-oxazole is Cc1nc(CN2C[C@H](c3ccccc3)C(C)(C)C2)co1.
What is the InChIKey of 4-[[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]methyl]-2-methyl-1,3-oxazole?
The InChIKey is BHMGNOLLQPCBIA-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H22N2O/c1-13-18-15(11-20-13)9-19-10-16(17(2,3)12-19)14-7-5-4-6-8-14/h4-8,11,16H,9-10,12H2,1-3H3/t16-/m1/s1.
What are the key properties of 4-[[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]methyl]-2-methyl-1,3-oxazole?
4-[[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]methyl]-2-methyl-1,3-oxazole has a molecular weight of 270.38 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]methyl]-2-methyl-1,3-oxazole is sourced from PubChem (CID 126451372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).