C14H22N6 — CID 126452125
N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-4-ethyl-5-methylpyrimidin-2-amine (PubChem CID 126452125) has the molecular formula C14H22N6 and a molecular weight of 274.37 g/mol. Its IUPAC name is N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-4-ethyl-5-methylpyrimidin-2-amine.
| Compound Name | N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-4-ethyl-5-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 126452125 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-4-ethyl-5-methylpyrimidin-2-amine |
| SMILES | CCc1nc(NCCCn2nc(C)nc2C)ncc1C |
| InChI | InChI=1S/C14H22N6/c1-5-13-10(2)9-16-14(18-13)15-7-6-8-20-12(4)17-11(3)19-20/h9H,5-8H2,1-4H3,(H,15,16,18) |
| InChIKey | ZKJJINRXGAEVSN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|