C19H21N3O4 — CID 126452342
5-[3-[(3S)-3-acetamidopyrrolidine-1-carbonyl]phenyl]-N-methylfuran-2-carboxamide (PubChem CID 126452342) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 5-[3-[(3S)-3-acetamidopyrrolidine-1-carbonyl]phenyl]-N-methylfuran-2-carboxamide.
| Compound Name | 5-[3-[(3S)-3-acetamidopyrrolidine-1-carbonyl]phenyl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 126452342 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 5-[3-[(3S)-3-acetamidopyrrolidine-1-carbonyl]phenyl]-N-methylfuran-2-carboxamide |
| SMILES | CNC(=O)c1ccc(-c2cccc(C(=O)N3CC[C@H](NC(C)=O)C3)c2)o1 |
| InChI | InChI=1S/C19H21N3O4/c1-12(23)21-15-8-9-22(11-15)19(25)14-5-3-4-13(10-14)16-6-7-17(26-16)18(24)20-2/h3-7,10,15H,8-9,11H2,1-2H3,(H,20,24)(H,21,23)/t15-/m0/s1 |
| InChIKey | ZCYCXSUEEJYATD-HNNXBMFYSA-N |
| XLogP | 1.66 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |