C20H24N2O4 — CID 126452673
5-[4-[(3S)-3-propoxypiperidine-1-carbonyl]phenyl]furan-2-carboxamide (PubChem CID 126452673) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 5-[4-[(3S)-3-propoxypiperidine-1-carbonyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-[4-[(3S)-3-propoxypiperidine-1-carbonyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126452673 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 5-[4-[(3S)-3-propoxypiperidine-1-carbonyl]phenyl]furan-2-carboxamide |
| SMILES | CCCO[C@H]1CCCN(C(=O)c2ccc(-c3ccc(C(N)=O)o3)cc2)C1 |
| InChI | InChI=1S/C20H24N2O4/c1-2-12-25-16-4-3-11-22(13-16)20(24)15-7-5-14(6-8-15)17-9-10-18(26-17)19(21)23/h5-10,16H,2-4,11-13H2,1H3,(H2,21,23)/t16-/m0/s1 |
| InChIKey | YGTWPVQWCLLACE-INIZCTEOSA-N |
| XLogP | 3.08 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |