C19H25FN4O2 — CID 126453434
3-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1-methyl-1-[3-[(2R)-oxolan-2-yl]propyl]urea (PubChem CID 126453434) has the molecular formula C19H25FN4O2 and a molecular weight of 360.43 g/mol. Its IUPAC name is 3-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1-methyl-1-[3-[(2R)-oxolan-2-yl]propyl]urea.
| Compound Name | 3-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1-methyl-1-[3-[(2R)-oxolan-2-yl]propyl]urea |
|---|---|
| PubChem CID | 126453434 |
| Molecular Formula | C19H25FN4O2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 3-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1-methyl-1-[3-[(2R)-oxolan-2-yl]propyl]urea |
| SMILES | CN(CCC[C@@H]1CCCO1)C(=O)NCc1cnn(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H25FN4O2/c1-23(10-2-4-18-5-3-11-26-18)19(25)21-12-15-13-22-24(14-15)17-8-6-16(20)7-9-17/h6-9,13-14,18H,2-5,10-12H2,1H3,(H,21,25)/t18-/m1/s1 |
| InChIKey | QQBPLXFDUBACFK-GOSISDBHSA-N |
| XLogP | 3.11 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |