About (3S)-1-(2,6-dimethyl-4-oxo-1H-pyridine-3-carbonyl)piperidine-3-carbonitrile
(3S)-1-(2,6-dimethyl-4-oxo-1H-pyridine-3-carbonyl)piperidine-3-carbonitrile (PubChem CID 126454483) has the molecular formula C14H17N3O2
and a molecular weight of 259.31 g/mol. Its IUPAC name is (3S)-1-(2,6-dimethyl-4-oxo-1H-pyridine-3-carbonyl)piperidine-3-carbonitrile.
Molecular Properties
| Compound Name | (3S)-1-(2,6-dimethyl-4-oxo-1H-pyridine-3-carbonyl)piperidine-3-carbonitrile |
| PubChem CID | 126454483 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (3S)-1-(2,6-dimethyl-4-oxo-1H-pyridine-3-carbonyl)piperidine-3-carbonitrile |
| SMILES | Cc1cc(=O)c(C(=O)N2CCC[C@H](C#N)C2)c(C)[nH]1 |
| InChI | InChI=1S/C14H17N3O2/c1-9-6-12(18)13(10(2)16-9)14(19)17-5-3-4-11(7-15)8-17/h6,11H,3-5,8H2,1-2H3,(H,16,18)/t11-/m1/s1 |
| InChIKey | SRGLERUFOPNZQV-LLVKDONJSA-N |
| XLogP | 1.37 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-1-(2,6-dimethyl-4-oxo-1H-pyridine-3-carbonyl)piperidine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(2,6-dimethyl-4-oxo-1H-pyridine-3-carbonyl)piperidine-3-carbonitrile?
The IUPAC name of (3S)-1-(2,6-dimethyl-4-oxo-1H-pyridine-3-carbonyl)piperidine-3-carbonitrile (CID 126454483) is (3S)-1-(2,6-dimethyl-4-oxo-1H-pyridine-3-carbonyl)piperidine-3-carbonitrile.
What is the SMILES notation for (3S)-1-(2,6-dimethyl-4-oxo-1H-pyridine-3-carbonyl)piperidine-3-carbonitrile?
The canonical SMILES for (3S)-1-(2,6-dimethyl-4-oxo-1H-pyridine-3-carbonyl)piperidine-3-carbonitrile is Cc1cc(=O)c(C(=O)N2CCC[C@H](C#N)C2)c(C)[nH]1.
What is the InChIKey of (3S)-1-(2,6-dimethyl-4-oxo-1H-pyridine-3-carbonyl)piperidine-3-carbonitrile?
The InChIKey is SRGLERUFOPNZQV-LLVKDONJSA-N. The full InChI is InChI=1S/C14H17N3O2/c1-9-6-12(18)13(10(2)16-9)14(19)17-5-3-4-11(7-15)8-17/h6,11H,3-5,8H2,1-2H3,(H,16,18)/t11-/m1/s1.
What are the key properties of (3S)-1-(2,6-dimethyl-4-oxo-1H-pyridine-3-carbonyl)piperidine-3-carbonitrile?
(3S)-1-(2,6-dimethyl-4-oxo-1H-pyridine-3-carbonyl)piperidine-3-carbonitrile has a molecular weight of 259.31 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(2,6-dimethyl-4-oxo-1H-pyridine-3-carbonyl)piperidine-3-carbonitrile is sourced from PubChem (CID 126454483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).