About (4-fluoropiperidin-1-yl) benzoate
(4-fluoropiperidin-1-yl) benzoate (PubChem CID 126455138) has the molecular formula C12H14FNO2
and a molecular weight of 223.25 g/mol. Its IUPAC name is (4-fluoropiperidin-1-yl) benzoate.
Molecular Properties
| Compound Name | (4-fluoropiperidin-1-yl) benzoate |
| PubChem CID | 126455138 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (4-fluoropiperidin-1-yl) benzoate |
| SMILES | O=C(ON1CCC(F)CC1)c1ccccc1 |
| InChI | InChI=1S/C12H14FNO2/c13-11-6-8-14(9-7-11)16-12(15)10-4-2-1-3-5-10/h1-5,11H,6-9H2 |
| InChIKey | UWCJQXPVPRMFPU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-fluoropiperidin-1-yl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluoropiperidin-1-yl) benzoate?
The IUPAC name of (4-fluoropiperidin-1-yl) benzoate (CID 126455138) is (4-fluoropiperidin-1-yl) benzoate.
What is the SMILES notation for (4-fluoropiperidin-1-yl) benzoate?
The canonical SMILES for (4-fluoropiperidin-1-yl) benzoate is O=C(ON1CCC(F)CC1)c1ccccc1.
What is the InChIKey of (4-fluoropiperidin-1-yl) benzoate?
The InChIKey is UWCJQXPVPRMFPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO2/c13-11-6-8-14(9-7-11)16-12(15)10-4-2-1-3-5-10/h1-5,11H,6-9H2.
What are the key properties of (4-fluoropiperidin-1-yl) benzoate?
(4-fluoropiperidin-1-yl) benzoate has a molecular weight of 223.25 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluoropiperidin-1-yl) benzoate is sourced from PubChem (CID 126455138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).