C12H16NO2- — CID 126456344
4-methyl-1-oxido-6-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)pyridin-2-one (PubChem CID 126456344) has the molecular formula C12H16NO2- and a molecular weight of 217.33 g/mol. Its IUPAC name is 4-methyl-1-oxido-6-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)pyridin-2-one.
| Compound Name | 4-methyl-1-oxido-6-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)pyridin-2-one |
|---|---|
| PubChem CID | 126456344 |
| Molecular Formula | C12H16NO2- |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.19 |
| IUPAC Name | 4-methyl-1-oxido-6-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)pyridin-2-one |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])([2H])C([2H])(c2cc(C)cc(=O)n2[O-])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C12H16NO2/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10/h7-8,10H,2-6H2,1H3/q-1/i2D2,3D2,4D2,5D2,6D2,10D |
| InChIKey | USUWCRYVPHKJCJ-WOHCQCBNSA-N |
| XLogP | 2.55 |
| TPSA | 45.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|