C17H20N5O6- — CID 126456461
7-methyl-8-(methylamino)-4-oxo-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridin-2-olate (PubChem CID 126456461) has the molecular formula C17H20N5O6- and a molecular weight of 390.38 g/mol. Its IUPAC name is 7-methyl-8-(methylamino)-4-oxo-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridin-2-olate.
| Compound Name | 7-methyl-8-(methylamino)-4-oxo-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridin-2-olate |
|---|---|
| PubChem CID | 126456461 |
| Molecular Formula | C17H20N5O6- |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 7-methyl-8-(methylamino)-4-oxo-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridin-2-olate |
| SMILES | CNc1cc2c(cc1C)nc1c(=O)nc([O-])nc-1n2C[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C17H21N5O6/c1-7-3-9-10(4-8(7)18-2)22(5-11(24)14(26)12(25)6-23)15-13(19-9)16(27)21-17(28)20-15/h3-4,11-12,14,18,23-26H,5-6H2,1-2H3,(H,21,27,28)/p-1/t11-,12+,14-/m0/s1 |
| InChIKey | PWZSYWZSTDXLFL-SCRDCRAPSA-M |
| XLogP | -2.21 |
| TPSA | 176.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|