C17H14F3N3O4S — CID 126458528
3-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide (PubChem CID 126458528) has the molecular formula C17H14F3N3O4S and a molecular weight of 413.38 g/mol. Its IUPAC name is 3-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide.
| Compound Name | 3-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide |
|---|---|
| PubChem CID | 126458528 |
| Molecular Formula | C17H14F3N3O4S |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 3-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide |
| SMILES | CC1C(=O)Nc2ccc(S(=O)(=O)Nc3cccc(C(F)(F)F)c3)cc2NC1=O |
| InChI | InChI=1S/C17H14F3N3O4S/c1-9-15(24)21-13-6-5-12(8-14(13)22-16(9)25)28(26,27)23-11-4-2-3-10(7-11)17(18,19)20/h2-9,23H,1H3,(H,21,24)(H,22,25) |
| InChIKey | GASYHGJCPAKPFG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|