C22H29N3O2 — CID 126459377
1'-methyl-6-(4-methylpiperidine-1-carbonyl)spiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-indole]-2'-one (PubChem CID 126459377) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1'-methyl-6-(4-methylpiperidine-1-carbonyl)spiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-indole]-2'-one.
| Compound Name | 1'-methyl-6-(4-methylpiperidine-1-carbonyl)spiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-indole]-2'-one |
|---|---|
| PubChem CID | 126459377 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 1'-methyl-6-(4-methylpiperidine-1-carbonyl)spiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-indole]-2'-one |
| SMILES | CC1CCN(C(=O)C2CC3CCCN3C23C(=O)N(C)c2ccccc23)CC1 |
| InChI | InChI=1S/C22H29N3O2/c1-15-9-12-24(13-10-15)20(26)18-14-16-6-5-11-25(16)22(18)17-7-3-4-8-19(17)23(2)21(22)27/h3-4,7-8,15-16,18H,5-6,9-14H2,1-2H3 |
| InChIKey | OMSWJNBKYCXBNL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |