C21H30N2O4S2 — CID 126459731
N-cyclooctyl-3-[(2-ethyl-3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]propanamide (PubChem CID 126459731) has the molecular formula C21H30N2O4S2 and a molecular weight of 438.62 g/mol. Its IUPAC name is N-cyclooctyl-3-[(2-ethyl-3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]propanamide.
| Compound Name | N-cyclooctyl-3-[(2-ethyl-3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]propanamide |
|---|---|
| PubChem CID | 126459731 |
| Molecular Formula | C21H30N2O4S2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-cyclooctyl-3-[(2-ethyl-3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]propanamide |
| SMILES | CCC1Sc2cc(S(=O)(=O)CCC(=O)NC3CCCCCCC3)ccc2NC1=O |
| InChI | InChI=1S/C21H30N2O4S2/c1-2-18-21(25)23-17-11-10-16(14-19(17)28-18)29(26,27)13-12-20(24)22-15-8-6-4-3-5-7-9-15/h10-11,14-15,18H,2-9,12-13H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | RZDYEKWRPHTVKG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |