C20H27N3O2 — CID 126459734
N-butan-2-yl-1'-methyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxamide (PubChem CID 126459734) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-butan-2-yl-1'-methyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxamide.
| Compound Name | N-butan-2-yl-1'-methyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxamide |
|---|---|
| PubChem CID | 126459734 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-butan-2-yl-1'-methyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxamide |
| SMILES | CCC(C)NC(=O)C1CC2CCCN2C12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C20H27N3O2/c1-4-13(2)21-18(24)16-12-14-8-7-11-23(14)20(16)15-9-5-6-10-17(15)22(3)19(20)25/h5-6,9-10,13-14,16H,4,7-8,11-12H2,1-3H3,(H,21,24) |
| InChIKey | CDISUUREIWQZGT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |