About N-cyclohexyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide;hydrochloride
N-cyclohexyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide;hydrochloride (PubChem CID 126460304) has the molecular formula C11H20ClN3O2S
and a molecular weight of 293.82 g/mol. Its IUPAC name is N-cyclohexyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-cyclohexyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide;hydrochloride |
| PubChem CID | 126460304 |
| Molecular Formula | C11H20ClN3O2S |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-cyclohexyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide;hydrochloride |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NC1CCCCC1.Cl |
| InChI | InChI=1S/C11H19N3O2S.ClH/c1-8-11(9(2)13-12-8)17(15,16)14-10-6-4-3-5-7-10;/h10,14H,3-7H2,1-2H3,(H,12,13);1H |
| InChIKey | JZAASCKWDREUJG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide;hydrochloride?
The IUPAC name of N-cyclohexyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide;hydrochloride (CID 126460304) is N-cyclohexyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide;hydrochloride.
What is the SMILES notation for N-cyclohexyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide;hydrochloride?
The canonical SMILES for N-cyclohexyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide;hydrochloride is Cc1n[nH]c(C)c1S(=O)(=O)NC1CCCCC1.Cl.
What is the InChIKey of N-cyclohexyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide;hydrochloride?
The InChIKey is JZAASCKWDREUJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2S.ClH/c1-8-11(9(2)13-12-8)17(15,16)14-10-6-4-3-5-7-10;/h10,14H,3-7H2,1-2H3,(H,12,13);1H.
What are the key properties of N-cyclohexyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide;hydrochloride?
N-cyclohexyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide;hydrochloride has a molecular weight of 293.82 g/mol, XLogP of 2.06, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide;hydrochloride is sourced from PubChem (CID 126460304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).