C16H25ClN2O4 — CID 126460418
N-[(4-chlorophenyl)methyl]-N',N'-diethylpropane-1,3-diamine;oxalic acid (PubChem CID 126460418) has the molecular formula C16H25ClN2O4 and a molecular weight of 344.84 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N',N'-diethylpropane-1,3-diamine;oxalic acid.
| Compound Name | N-[(4-chlorophenyl)methyl]-N',N'-diethylpropane-1,3-diamine;oxalic acid |
|---|---|
| PubChem CID | 126460418 |
| Molecular Formula | C16H25ClN2O4 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N',N'-diethylpropane-1,3-diamine;oxalic acid |
| SMILES | CCN(CC)CCCNCc1ccc(Cl)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H23ClN2.C2H2O4/c1-3-17(4-2)11-5-10-16-12-13-6-8-14(15)9-7-13;3-1(4)2(5)6/h6-9,16H,3-5,10-12H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | SSDXWJHRBWILKB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|