About 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-3,5-dimethylpiperidine;hydrochloride
1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-3,5-dimethylpiperidine;hydrochloride (PubChem CID 126460444) has the molecular formula C12H22ClN3O2S
and a molecular weight of 307.85 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-3,5-dimethylpiperidine;hydrochloride.
Molecular Properties
| Compound Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-3,5-dimethylpiperidine;hydrochloride |
| PubChem CID | 126460444 |
| Molecular Formula | C12H22ClN3O2S |
| Molecular Weight | 307.85 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-3,5-dimethylpiperidine;hydrochloride |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N1CC(C)CC(C)C1.Cl |
| InChI | InChI=1S/C12H21N3O2S.ClH/c1-8-5-9(2)7-15(6-8)18(16,17)12-10(3)13-14-11(12)4;/h8-9H,5-7H2,1-4H3,(H,13,14);1H |
| InChIKey | MDOLKLGZOSEQGY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.85 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-3,5-dimethylpiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-3,5-dimethylpiperidine;hydrochloride?
The IUPAC name of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-3,5-dimethylpiperidine;hydrochloride (CID 126460444) is 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-3,5-dimethylpiperidine;hydrochloride.
What is the SMILES notation for 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-3,5-dimethylpiperidine;hydrochloride?
The canonical SMILES for 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-3,5-dimethylpiperidine;hydrochloride is Cc1n[nH]c(C)c1S(=O)(=O)N1CC(C)CC(C)C1.Cl.
What is the InChIKey of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-3,5-dimethylpiperidine;hydrochloride?
The InChIKey is MDOLKLGZOSEQGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2S.ClH/c1-8-5-9(2)7-15(6-8)18(16,17)12-10(3)13-14-11(12)4;/h8-9H,5-7H2,1-4H3,(H,13,14);1H.
What are the key properties of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-3,5-dimethylpiperidine;hydrochloride?
1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-3,5-dimethylpiperidine;hydrochloride has a molecular weight of 307.85 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-3,5-dimethylpiperidine;hydrochloride is sourced from PubChem (CID 126460444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).