C23H25FN4O3S — CID 126460466
1-[(3R,7S,8aS)-3-(benzylsulfanylmethyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[(3-fluorophenyl)methyl]urea (PubChem CID 126460466) has the molecular formula C23H25FN4O3S and a molecular weight of 456.54 g/mol. Its IUPAC name is 1-[(3R,7S,8aS)-3-(benzylsulfanylmethyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[(3-fluorophenyl)methyl]urea.
| Compound Name | 1-[(3R,7S,8aS)-3-(benzylsulfanylmethyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[(3-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 126460466 |
| Molecular Formula | C23H25FN4O3S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 1-[(3R,7S,8aS)-3-(benzylsulfanylmethyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-[(3-fluorophenyl)methyl]urea |
| SMILES | O=C(NCc1cccc(F)c1)N[C@H]1C[C@H]2C(=O)N[C@@H](CSCc3ccccc3)C(=O)N2C1 |
| InChI | InChI=1S/C23H25FN4O3S/c24-17-8-4-7-16(9-17)11-25-23(31)26-18-10-20-21(29)27-19(22(30)28(20)12-18)14-32-13-15-5-2-1-3-6-15/h1-9,18-20H,10-14H2,(H,27,29)(H2,25,26,31)/t18-,19-,20-/m0/s1 |
| InChIKey | ACCDUMVJRDBROH-UFYCRDLUSA-N |
| XLogP | 2.03 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |