C21H21N3O5 — CID 126460530
naphthalen-1-yl (3S,5R,9R)-5-hydroxy-2,8-dioxo-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-11-carboxylate (PubChem CID 126460530) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is naphthalen-1-yl (3S,5R,9R)-5-hydroxy-2,8-dioxo-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-11-carboxylate.
| Compound Name | naphthalen-1-yl (3S,5R,9R)-5-hydroxy-2,8-dioxo-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-11-carboxylate |
|---|---|
| PubChem CID | 126460530 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | naphthalen-1-yl (3S,5R,9R)-5-hydroxy-2,8-dioxo-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-11-carboxylate |
| SMILES | O=C(Oc1cccc2ccccc12)N1CCN2C(=O)[C@@H]3C[C@@H](O)CN3C(=O)[C@H]2C1 |
| InChI | InChI=1S/C21H21N3O5/c25-14-10-16-19(26)23-9-8-22(12-17(23)20(27)24(16)11-14)21(28)29-18-7-3-5-13-4-1-2-6-15(13)18/h1-7,14,16-17,25H,8-12H2/t14-,16+,17-/m1/s1 |
| InChIKey | CEHGFFFHGHTHDI-HYVNUMGLSA-N |
| XLogP | 0.83 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |