About 1,1-dioxo-4-(piperidin-4-ylamino)thiolan-3-ol;hydrochloride
1,1-dioxo-4-(piperidin-4-ylamino)thiolan-3-ol;hydrochloride (PubChem CID 126460539) has the molecular formula C9H19ClN2O3S
and a molecular weight of 270.78 g/mol. Its IUPAC name is 1,1-dioxo-4-(piperidin-4-ylamino)thiolan-3-ol;hydrochloride.
Molecular Properties
| Compound Name | 1,1-dioxo-4-(piperidin-4-ylamino)thiolan-3-ol;hydrochloride |
| PubChem CID | 126460539 |
| Molecular Formula | C9H19ClN2O3S |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 1,1-dioxo-4-(piperidin-4-ylamino)thiolan-3-ol;hydrochloride |
| SMILES | Cl.O=S1(=O)CC(O)C(NC2CCNCC2)C1 |
| InChI | InChI=1S/C9H18N2O3S.ClH/c12-9-6-15(13,14)5-8(9)11-7-1-3-10-4-2-7;/h7-12H,1-6H2;1H |
| InChIKey | QZWMFTNKVUPUIX-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,1-dioxo-4-(piperidin-4-ylamino)thiolan-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-4-(piperidin-4-ylamino)thiolan-3-ol;hydrochloride?
The IUPAC name of 1,1-dioxo-4-(piperidin-4-ylamino)thiolan-3-ol;hydrochloride (CID 126460539) is 1,1-dioxo-4-(piperidin-4-ylamino)thiolan-3-ol;hydrochloride.
What is the SMILES notation for 1,1-dioxo-4-(piperidin-4-ylamino)thiolan-3-ol;hydrochloride?
The canonical SMILES for 1,1-dioxo-4-(piperidin-4-ylamino)thiolan-3-ol;hydrochloride is Cl.O=S1(=O)CC(O)C(NC2CCNCC2)C1.
What is the InChIKey of 1,1-dioxo-4-(piperidin-4-ylamino)thiolan-3-ol;hydrochloride?
The InChIKey is QZWMFTNKVUPUIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O3S.ClH/c12-9-6-15(13,14)5-8(9)11-7-1-3-10-4-2-7;/h7-12H,1-6H2;1H.
What are the key properties of 1,1-dioxo-4-(piperidin-4-ylamino)thiolan-3-ol;hydrochloride?
1,1-dioxo-4-(piperidin-4-ylamino)thiolan-3-ol;hydrochloride has a molecular weight of 270.78 g/mol, XLogP of -1.09, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-4-(piperidin-4-ylamino)thiolan-3-ol;hydrochloride is sourced from PubChem (CID 126460539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).