C24H23FN4O3S — CID 126460755
(7S,9aR)-2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-7-[(4-hydroxyphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 126460755) has the molecular formula C24H23FN4O3S and a molecular weight of 466.54 g/mol. Its IUPAC name is (7S,9aR)-2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-7-[(4-hydroxyphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-7-[(4-hydroxyphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 126460755 |
| Molecular Formula | C24H23FN4O3S |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | (7S,9aR)-2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-7-[(4-hydroxyphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | O=C1N[C@@H](Cc2ccc(O)cc2)C(=O)N2CCN(Cc3nc(-c4ccc(F)cc4)cs3)C[C@H]12 |
| InChI | InChI=1S/C24H23FN4O3S/c25-17-5-3-16(4-6-17)20-14-33-22(26-20)13-28-9-10-29-21(12-28)23(31)27-19(24(29)32)11-15-1-7-18(30)8-2-15/h1-8,14,19,21,30H,9-13H2,(H,27,31)/t19-,21+/m0/s1 |
| InChIKey | FTBHMIHLQRTMPM-PZJWPPBQSA-N |
| XLogP | 2.41 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |