C24H24FN5O3 — CID 126461021
(3R,7S,8aS)-7-[[1-(2-fluorophenyl)pyrazol-4-yl]methylamino]-3-[(4-hydroxyphenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 126461021) has the molecular formula C24H24FN5O3 and a molecular weight of 449.49 g/mol. Its IUPAC name is (3R,7S,8aS)-7-[[1-(2-fluorophenyl)pyrazol-4-yl]methylamino]-3-[(4-hydroxyphenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3R,7S,8aS)-7-[[1-(2-fluorophenyl)pyrazol-4-yl]methylamino]-3-[(4-hydroxyphenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 126461021 |
| Molecular Formula | C24H24FN5O3 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | (3R,7S,8aS)-7-[[1-(2-fluorophenyl)pyrazol-4-yl]methylamino]-3-[(4-hydroxyphenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1N[C@H](Cc2ccc(O)cc2)C(=O)N2C[C@@H](NCc3cnn(-c4ccccc4F)c3)C[C@@H]12 |
| InChI | InChI=1S/C24H24FN5O3/c25-19-3-1-2-4-21(19)30-13-16(12-27-30)11-26-17-10-22-23(32)28-20(24(33)29(22)14-17)9-15-5-7-18(31)8-6-15/h1-8,12-13,17,20,22,26,31H,9-11,14H2,(H,28,32)/t17-,20+,22-/m0/s1 |
| InChIKey | YIZVUFZBSIZZBF-WEYGHZABSA-N |
| XLogP | 1.52 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |