C18H23FN4O4 — CID 126461061
(4-fluorophenyl) N-[(3S,7S,8aS)-3-(4-aminobutyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]carbamate (PubChem CID 126461061) has the molecular formula C18H23FN4O4 and a molecular weight of 378.40 g/mol. Its IUPAC name is (4-fluorophenyl) N-[(3S,7S,8aS)-3-(4-aminobutyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]carbamate.
| Compound Name | (4-fluorophenyl) N-[(3S,7S,8aS)-3-(4-aminobutyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]carbamate |
|---|---|
| PubChem CID | 126461061 |
| Molecular Formula | C18H23FN4O4 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (4-fluorophenyl) N-[(3S,7S,8aS)-3-(4-aminobutyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]carbamate |
| SMILES | NCCCC[C@@H]1NC(=O)[C@@H]2C[C@H](NC(=O)Oc3ccc(F)cc3)CN2C1=O |
| InChI | InChI=1S/C18H23FN4O4/c19-11-4-6-13(7-5-11)27-18(26)21-12-9-15-16(24)22-14(3-1-2-8-20)17(25)23(15)10-12/h4-7,12,14-15H,1-3,8-10,20H2,(H,21,26)(H,22,24)/t12-,14-,15-/m0/s1 |
| InChIKey | DIROKVSHBOUNKB-QEJZJMRPSA-N |
| XLogP | 0.51 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|