C16H19N3O4 — CID 126461314
(4-methylphenyl) (7R,9aR)-7-methyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate (PubChem CID 126461314) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is (4-methylphenyl) (7R,9aR)-7-methyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate.
| Compound Name | (4-methylphenyl) (7R,9aR)-7-methyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 126461314 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (4-methylphenyl) (7R,9aR)-7-methyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate |
| SMILES | Cc1ccc(OC(=O)N2CCN3C(=O)[C@@H](C)NC(=O)[C@H]3C2)cc1 |
| InChI | InChI=1S/C16H19N3O4/c1-10-3-5-12(6-4-10)23-16(22)18-7-8-19-13(9-18)14(20)17-11(2)15(19)21/h3-6,11,13H,7-9H2,1-2H3,(H,17,20)/t11-,13-/m1/s1 |
| InChIKey | DHDJCUXAKURNGY-DGCLKSJQSA-N |
| XLogP | 0.52 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |