C26H25ClN6O2 — CID 126461390
(3S,7S,8aS)-7-[[1-(3-chlorophenyl)pyrazol-4-yl]methylamino]-3-(1H-indol-3-ylmethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 126461390) has the molecular formula C26H25ClN6O2 and a molecular weight of 488.98 g/mol. Its IUPAC name is (3S,7S,8aS)-7-[[1-(3-chlorophenyl)pyrazol-4-yl]methylamino]-3-(1H-indol-3-ylmethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3S,7S,8aS)-7-[[1-(3-chlorophenyl)pyrazol-4-yl]methylamino]-3-(1H-indol-3-ylmethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 126461390 |
| Molecular Formula | C26H25ClN6O2 |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | (3S,7S,8aS)-7-[[1-(3-chlorophenyl)pyrazol-4-yl]methylamino]-3-(1H-indol-3-ylmethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N2C[C@@H](NCc3cnn(-c4cccc(Cl)c4)c3)C[C@@H]12 |
| InChI | InChI=1S/C26H25ClN6O2/c27-18-4-3-5-20(9-18)33-14-16(12-30-33)11-28-19-10-24-25(34)31-23(26(35)32(24)15-19)8-17-13-29-22-7-2-1-6-21(17)22/h1-7,9,12-14,19,23-24,28-29H,8,10-11,15H2,(H,31,34)/t19-,23-,24-/m0/s1 |
| InChIKey | TWWDFLOLEOBCGR-IGKWTDBASA-N |
| XLogP | 2.81 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |