C22H24FN3O3 — CID 126461550
(7R,9aR)-2-[(2-fluoro-5-methylphenyl)methyl]-7-[(4-hydroxyphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 126461550) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is (7R,9aR)-2-[(2-fluoro-5-methylphenyl)methyl]-7-[(4-hydroxyphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7R,9aR)-2-[(2-fluoro-5-methylphenyl)methyl]-7-[(4-hydroxyphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 126461550 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (7R,9aR)-2-[(2-fluoro-5-methylphenyl)methyl]-7-[(4-hydroxyphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | Cc1ccc(F)c(CN2CCN3C(=O)[C@@H](Cc4ccc(O)cc4)NC(=O)[C@H]3C2)c1 |
| InChI | InChI=1S/C22H24FN3O3/c1-14-2-7-18(23)16(10-14)12-25-8-9-26-20(13-25)21(28)24-19(22(26)29)11-15-3-5-17(27)6-4-15/h2-7,10,19-20,27H,8-9,11-13H2,1H3,(H,24,28)/t19-,20-/m1/s1 |
| InChIKey | BLSYEDALULFDNS-WOJBJXKFSA-N |
| XLogP | 1.59 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |