C18H25N3O4 — CID 126462207
(3S,7S,8aS)-7-[[4-methoxy-3-(methoxymethyl)phenyl]methylamino]-3-methyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 126462207) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is (3S,7S,8aS)-7-[[4-methoxy-3-(methoxymethyl)phenyl]methylamino]-3-methyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3S,7S,8aS)-7-[[4-methoxy-3-(methoxymethyl)phenyl]methylamino]-3-methyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 126462207 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | (3S,7S,8aS)-7-[[4-methoxy-3-(methoxymethyl)phenyl]methylamino]-3-methyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | COCc1cc(CN[C@H]2C[C@H]3C(=O)N[C@@H](C)C(=O)N3C2)ccc1OC |
| InChI | InChI=1S/C18H25N3O4/c1-11-18(23)21-9-14(7-15(21)17(22)20-11)19-8-12-4-5-16(25-3)13(6-12)10-24-2/h4-6,11,14-15,19H,7-10H2,1-3H3,(H,20,22)/t11-,14-,15-/m0/s1 |
| InChIKey | OUNBBZGRMQCHRH-CQDKDKBSSA-N |
| XLogP | 0.42 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|