C23H26F3N3O2 — CID 126462517
N-[[8-(pyridin-4-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]-2-(2,3,6-trifluorophenyl)acetamide (PubChem CID 126462517) has the molecular formula C23H26F3N3O2 and a molecular weight of 433.47 g/mol. Its IUPAC name is N-[[8-(pyridin-4-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]-2-(2,3,6-trifluorophenyl)acetamide.
| Compound Name | N-[[8-(pyridin-4-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]-2-(2,3,6-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 126462517 |
| Molecular Formula | C23H26F3N3O2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-[[8-(pyridin-4-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]-2-(2,3,6-trifluorophenyl)acetamide |
| SMILES | O=C(Cc1c(F)ccc(F)c1F)NCC1CCC2(CCN(Cc3ccncc3)CC2)O1 |
| InChI | InChI=1S/C23H26F3N3O2/c24-19-1-2-20(25)22(26)18(19)13-21(30)28-14-17-3-6-23(31-17)7-11-29(12-8-23)15-16-4-9-27-10-5-16/h1-2,4-5,9-10,17H,3,6-8,11-15H2,(H,28,30) |
| InChIKey | LGYXCERWISCNNY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|