C19H32N4O — CID 126462601
1-[(4aR,8aS)-6-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 126462601) has the molecular formula C19H32N4O and a molecular weight of 332.49 g/mol. Its IUPAC name is 1-[(4aR,8aS)-6-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[(4aR,8aS)-6-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 126462601 |
| Molecular Formula | C19H32N4O |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | 1-[(4aR,8aS)-6-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | Cc1[nH]cnc1CN1CC[C@H]2[C@H](CCCN2C(=O)CC(C)(C)C)C1 |
| InChI | InChI=1S/C19H32N4O/c1-14-16(21-13-20-14)12-22-9-7-17-15(11-22)6-5-8-23(17)18(24)10-19(2,3)4/h13,15,17H,5-12H2,1-4H3,(H,20,21)/t15-,17+/m1/s1 |
| InChIKey | YCAQQSXOFDOGLW-WBVHZDCISA-N |
| XLogP | 2.97 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |