C21H24N4O4S — CID 126463622
N-[1-(furan-2-yl)ethyl]-9-methoxy-7-oxo-3-(1,3-thiazol-2-ylmethyl)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide (PubChem CID 126463622) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is N-[1-(furan-2-yl)ethyl]-9-methoxy-7-oxo-3-(1,3-thiazol-2-ylmethyl)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide.
| Compound Name | N-[1-(furan-2-yl)ethyl]-9-methoxy-7-oxo-3-(1,3-thiazol-2-ylmethyl)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide |
|---|---|
| PubChem CID | 126463622 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-[1-(furan-2-yl)ethyl]-9-methoxy-7-oxo-3-(1,3-thiazol-2-ylmethyl)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide |
| SMILES | COc1cc(=O)n2c(c1C(=O)NC(C)c1ccco1)CCN(Cc1nccs1)CC2 |
| InChI | InChI=1S/C21H24N4O4S/c1-14(16-4-3-10-29-16)23-21(27)20-15-5-7-24(13-18-22-6-11-30-18)8-9-25(15)19(26)12-17(20)28-2/h3-4,6,10-12,14H,5,7-9,13H2,1-2H3,(H,23,27) |
| InChIKey | GJIDRFZLIIJSKB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |