C25H40N4O2 — CID 126463993
2-[4-[4-[(1-ethylpyrrolidin-2-yl)methylamino]piperidin-1-yl]phenyl]-1-(4-hydroxypiperidin-1-yl)ethanone (PubChem CID 126463993) has the molecular formula C25H40N4O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is 2-[4-[4-[(1-ethylpyrrolidin-2-yl)methylamino]piperidin-1-yl]phenyl]-1-(4-hydroxypiperidin-1-yl)ethanone.
| Compound Name | 2-[4-[4-[(1-ethylpyrrolidin-2-yl)methylamino]piperidin-1-yl]phenyl]-1-(4-hydroxypiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 126463993 |
| Molecular Formula | C25H40N4O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | 2-[4-[4-[(1-ethylpyrrolidin-2-yl)methylamino]piperidin-1-yl]phenyl]-1-(4-hydroxypiperidin-1-yl)ethanone |
| SMILES | CCN1CCCC1CNC1CCN(c2ccc(CC(=O)N3CCC(O)CC3)cc2)CC1 |
| InChI | InChI=1S/C25H40N4O2/c1-2-27-13-3-4-23(27)19-26-21-9-14-28(15-10-21)22-7-5-20(6-8-22)18-25(31)29-16-11-24(30)12-17-29/h5-8,21,23-24,26,30H,2-4,9-19H2,1H3 |
| InChIKey | DGHAJBHCDHWVHZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|