C20H19FN4O2S — CID 126465127
N-[(3-fluorophenyl)methyl]-2-[4-[(2-phenylsulfanylacetyl)amino]pyrazol-1-yl]acetamide (PubChem CID 126465127) has the molecular formula C20H19FN4O2S and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-2-[4-[(2-phenylsulfanylacetyl)amino]pyrazol-1-yl]acetamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-2-[4-[(2-phenylsulfanylacetyl)amino]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 126465127 |
| Molecular Formula | C20H19FN4O2S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-2-[4-[(2-phenylsulfanylacetyl)amino]pyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(NC(=O)CSc2ccccc2)cn1)NCc1cccc(F)c1 |
| InChI | InChI=1S/C20H19FN4O2S/c21-16-6-4-5-15(9-16)10-22-19(26)13-25-12-17(11-23-25)24-20(27)14-28-18-7-2-1-3-8-18/h1-9,11-12H,10,13-14H2,(H,22,26)(H,24,27) |
| InChIKey | SWTZPDNLBSFIIV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |