C22H32N2O4 — CID 126465358
methyl (2S,4S)-1-cyclooctyl-4-[(2-methoxybenzoyl)amino]pyrrolidine-2-carboxylate (PubChem CID 126465358) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is methyl (2S,4S)-1-cyclooctyl-4-[(2-methoxybenzoyl)amino]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-1-cyclooctyl-4-[(2-methoxybenzoyl)amino]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 126465358 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | methyl (2S,4S)-1-cyclooctyl-4-[(2-methoxybenzoyl)amino]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](NC(=O)c2ccccc2OC)CN1C1CCCCCCC1 |
| InChI | InChI=1S/C22H32N2O4/c1-27-20-13-9-8-12-18(20)21(25)23-16-14-19(22(26)28-2)24(15-16)17-10-6-4-3-5-7-11-17/h8-9,12-13,16-17,19H,3-7,10-11,14-15H2,1-2H3,(H,23,25)/t16-,19-/m0/s1 |
| InChIKey | ZJGVPXNCXAWOMS-LPHOPBHVSA-N |
| XLogP | 3.15 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |