C26H24N2O2 — CID 126466074
(1R,2R,4R)-N-[(7-pyridin-3-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 126466074) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is (1R,2R,4R)-N-[(7-pyridin-3-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4R)-N-[(7-pyridin-3-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 126466074 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (1R,2R,4R)-N-[(7-pyridin-3-yl-1,2-dihydrobenzo[e][1]benzofuran-2-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(NCC1Cc2c(ccc3cc(-c4cccnc4)ccc23)O1)[C@@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C26H24N2O2/c29-26(23-11-16-3-4-18(23)10-16)28-15-21-13-24-22-7-5-17(20-2-1-9-27-14-20)12-19(22)6-8-25(24)30-21/h1-9,12,14,16,18,21,23H,10-11,13,15H2,(H,28,29)/t16-,18+,21?,23-/m1/s1 |
| InChIKey | COBGGGPNIZPGBE-OCRPGGNVSA-N |
| XLogP | 4.53 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|