C24H32N2O3S — CID 126466116
1-[(4aR,8aR)-6-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-(3,4-dimethoxyphenyl)propan-1-one (PubChem CID 126466116) has the molecular formula C24H32N2O3S and a molecular weight of 428.60 g/mol. Its IUPAC name is 1-[(4aR,8aR)-6-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-(3,4-dimethoxyphenyl)propan-1-one.
| Compound Name | 1-[(4aR,8aR)-6-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-(3,4-dimethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 126466116 |
| Molecular Formula | C24H32N2O3S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-[(4aR,8aR)-6-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-(3,4-dimethoxyphenyl)propan-1-one |
| SMILES | COc1ccc(CCC(=O)N2CCC[C@@H]3CN(Cc4cccs4)CC[C@H]32)cc1OC |
| InChI | InChI=1S/C24H32N2O3S/c1-28-22-9-7-18(15-23(22)29-2)8-10-24(27)26-12-3-5-19-16-25(13-11-21(19)26)17-20-6-4-14-30-20/h4,6-7,9,14-15,19,21H,3,5,8,10-13,16-17H2,1-2H3/t19-,21-/m1/s1 |
| InChIKey | RHXGNFODENRFEG-TZIWHRDSSA-N |
| XLogP | 4.21 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |