C23H36N6O2 — CID 126466828
5-oxo-N-[[7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]pyrrolidine-2-carboxamide (PubChem CID 126466828) has the molecular formula C23H36N6O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 5-oxo-N-[[7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | 5-oxo-N-[[7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 126466828 |
| Molecular Formula | C23H36N6O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 5-oxo-N-[[7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CC1=C(CCN2CCc3nnc(CNC(=O)C4CCC(=O)N4)n3CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C23H36N6O2/c1-16-5-4-10-23(2,3)17(16)8-11-28-12-9-19-26-27-20(29(19)14-13-28)15-24-22(31)18-6-7-21(30)25-18/h18H,4-15H2,1-3H3,(H,24,31)(H,25,30) |
| InChIKey | FTSVAPZLUJOHMG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|