C25H41N5O2 — CID 126466959
N-[2-[7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]oxane-4-carboxamide (PubChem CID 126466959) has the molecular formula C25H41N5O2 and a molecular weight of 443.64 g/mol. Its IUPAC name is N-[2-[7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]oxane-4-carboxamide.
| Compound Name | N-[2-[7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 126466959 |
| Molecular Formula | C25H41N5O2 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.33 |
| IUPAC Name | N-[2-[7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]oxane-4-carboxamide |
| SMILES | CC1=C(CCN2CCc3nnc(CCNC(=O)C4CCOCC4)n3CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C25H41N5O2/c1-19-5-4-11-25(2,3)21(19)7-13-29-14-8-23-28-27-22(30(23)16-15-29)6-12-26-24(31)20-9-17-32-18-10-20/h20H,4-18H2,1-3H3,(H,26,31) |
| InChIKey | FMRAGFBRFSQTTM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|