C19H24N2OS — CID 126467047
1-[(4aR,8aS)-6-(1-benzothiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]ethanone (PubChem CID 126467047) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is 1-[(4aR,8aS)-6-(1-benzothiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]ethanone.
| Compound Name | 1-[(4aR,8aS)-6-(1-benzothiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 126467047 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1-[(4aR,8aS)-6-(1-benzothiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@@H]2CN(Cc3cc4ccccc4s3)CC[C@@H]21 |
| InChI | InChI=1S/C19H24N2OS/c1-14(22)21-9-4-6-16-12-20(10-8-18(16)21)13-17-11-15-5-2-3-7-19(15)23-17/h2-3,5,7,11,16,18H,4,6,8-10,12-13H2,1H3/t16-,18+/m1/s1 |
| InChIKey | UWWPBYOIQXIKKL-AEFFLSMTSA-N |
| XLogP | 3.73 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |