C27H36N4O2 — CID 126467048
N-[[3-methyl-7-[(4-pyrrolidin-1-ylphenyl)methyl]-6,8-dihydro-5H-2,7-naphthyridin-4-yl]methyl]oxane-4-carboxamide (PubChem CID 126467048) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is N-[[3-methyl-7-[(4-pyrrolidin-1-ylphenyl)methyl]-6,8-dihydro-5H-2,7-naphthyridin-4-yl]methyl]oxane-4-carboxamide.
| Compound Name | N-[[3-methyl-7-[(4-pyrrolidin-1-ylphenyl)methyl]-6,8-dihydro-5H-2,7-naphthyridin-4-yl]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 126467048 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | N-[[3-methyl-7-[(4-pyrrolidin-1-ylphenyl)methyl]-6,8-dihydro-5H-2,7-naphthyridin-4-yl]methyl]oxane-4-carboxamide |
| SMILES | Cc1ncc2c(c1CNC(=O)C1CCOCC1)CCN(Cc1ccc(N3CCCC3)cc1)C2 |
| InChI | InChI=1S/C27H36N4O2/c1-20-26(17-29-27(32)22-9-14-33-15-10-22)25-8-13-30(19-23(25)16-28-20)18-21-4-6-24(7-5-21)31-11-2-3-12-31/h4-7,16,22H,2-3,8-15,17-19H2,1H3,(H,29,32) |
| InChIKey | GQZOOXIGBUEGCN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|