C18H24N2O2S — CID 126467131
(E)-1-[(4aR,8aR)-1-propanoyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 126467131) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is (E)-1-[(4aR,8aR)-1-propanoyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[(4aR,8aR)-1-propanoyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 126467131 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (E)-1-[(4aR,8aR)-1-propanoyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | CCC(=O)N1CCC[C@@H]2CN(C(=O)/C=C/c3cccs3)CC[C@H]21 |
| InChI | InChI=1S/C18H24N2O2S/c1-2-17(21)20-10-3-5-14-13-19(11-9-16(14)20)18(22)8-7-15-6-4-12-23-15/h4,6-8,12,14,16H,2-3,5,9-11,13H2,1H3/b8-7+/t14-,16-/m1/s1 |
| InChIKey | LWHUIOSZKPDCBV-XIHNBGGYSA-N |
| XLogP | 3.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|