C25H27N5O3 — CID 126467217
7-[[2-(3-methoxyphenyl)ethylamino]methyl]-N-methyl-N-(1H-pyrazol-5-ylmethyl)-[1,3]dioxolo[4,5-g]quinolin-6-amine (PubChem CID 126467217) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 7-[[2-(3-methoxyphenyl)ethylamino]methyl]-N-methyl-N-(1H-pyrazol-5-ylmethyl)-[1,3]dioxolo[4,5-g]quinolin-6-amine.
| Compound Name | 7-[[2-(3-methoxyphenyl)ethylamino]methyl]-N-methyl-N-(1H-pyrazol-5-ylmethyl)-[1,3]dioxolo[4,5-g]quinolin-6-amine |
|---|---|
| PubChem CID | 126467217 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 7-[[2-(3-methoxyphenyl)ethylamino]methyl]-N-methyl-N-(1H-pyrazol-5-ylmethyl)-[1,3]dioxolo[4,5-g]quinolin-6-amine |
| SMILES | COc1cccc(CCNCc2cc3cc4c(cc3nc2N(C)Cc2ccn[nH]2)OCO4)c1 |
| InChI | InChI=1S/C25H27N5O3/c1-30(15-20-7-9-27-29-20)25-19(14-26-8-6-17-4-3-5-21(10-17)31-2)11-18-12-23-24(33-16-32-23)13-22(18)28-25/h3-5,7,9-13,26H,6,8,14-16H2,1-2H3,(H,27,29) |
| InChIKey | XZSSBACWSVOPCE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|