C22H32N2O3 — CID 126467263
[(4aR,8aR)-6-(3-methylbutyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-(2,3-dihydro-1,4-benzodioxin-3-yl)methanone (PubChem CID 126467263) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is [(4aR,8aR)-6-(3-methylbutyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-(2,3-dihydro-1,4-benzodioxin-3-yl)methanone.
| Compound Name | [(4aR,8aR)-6-(3-methylbutyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-(2,3-dihydro-1,4-benzodioxin-3-yl)methanone |
|---|---|
| PubChem CID | 126467263 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | [(4aR,8aR)-6-(3-methylbutyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-(2,3-dihydro-1,4-benzodioxin-3-yl)methanone |
| SMILES | CC(C)CCN1CC[C@@H]2[C@H](CCCN2C(=O)C2COc3ccccc3O2)C1 |
| InChI | InChI=1S/C22H32N2O3/c1-16(2)9-12-23-13-10-18-17(14-23)6-5-11-24(18)22(25)21-15-26-19-7-3-4-8-20(19)27-21/h3-4,7-8,16-18,21H,5-6,9-15H2,1-2H3/t17-,18-,21?/m1/s1 |
| InChIKey | ZLCDHDDEQBBCGX-FYQIFJIOSA-N |
| XLogP | 3.19 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |