About 1-[(3,4-difluorophenyl)methyl]-5-pyrrolidin-1-ylazepan-2-one
1-[(3,4-difluorophenyl)methyl]-5-pyrrolidin-1-ylazepan-2-one (PubChem CID 126467604) has the molecular formula C17H22F2N2O
and a molecular weight of 308.37 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-5-pyrrolidin-1-ylazepan-2-one.
Molecular Properties
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-5-pyrrolidin-1-ylazepan-2-one |
| PubChem CID | 126467604 |
| Molecular Formula | C17H22F2N2O |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-5-pyrrolidin-1-ylazepan-2-one |
| SMILES | O=C1CCC(N2CCCC2)CCN1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H22F2N2O/c18-15-5-3-13(11-16(15)19)12-21-10-7-14(4-6-17(21)22)20-8-1-2-9-20/h3,5,11,14H,1-2,4,6-10,12H2 |
| InChIKey | SBRVJMUIKZSIKL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3,4-difluorophenyl)methyl]-5-pyrrolidin-1-ylazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-difluorophenyl)methyl]-5-pyrrolidin-1-ylazepan-2-one?
The IUPAC name of 1-[(3,4-difluorophenyl)methyl]-5-pyrrolidin-1-ylazepan-2-one (CID 126467604) is 1-[(3,4-difluorophenyl)methyl]-5-pyrrolidin-1-ylazepan-2-one.
What is the SMILES notation for 1-[(3,4-difluorophenyl)methyl]-5-pyrrolidin-1-ylazepan-2-one?
The canonical SMILES for 1-[(3,4-difluorophenyl)methyl]-5-pyrrolidin-1-ylazepan-2-one is O=C1CCC(N2CCCC2)CCN1Cc1ccc(F)c(F)c1.
What is the InChIKey of 1-[(3,4-difluorophenyl)methyl]-5-pyrrolidin-1-ylazepan-2-one?
The InChIKey is SBRVJMUIKZSIKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22F2N2O/c18-15-5-3-13(11-16(15)19)12-21-10-7-14(4-6-17(21)22)20-8-1-2-9-20/h3,5,11,14H,1-2,4,6-10,12H2.
What are the key properties of 1-[(3,4-difluorophenyl)methyl]-5-pyrrolidin-1-ylazepan-2-one?
1-[(3,4-difluorophenyl)methyl]-5-pyrrolidin-1-ylazepan-2-one has a molecular weight of 308.37 g/mol, XLogP of 2.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-difluorophenyl)methyl]-5-pyrrolidin-1-ylazepan-2-one is sourced from PubChem (CID 126467604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).